ChemNet > CAS > 5446-58-2 N-p-Toluenesulfonylimino-3,3'-dipropionic acid
5446-58-2 N-p-Toluenesulfonylimino-3,3'-dipropionic acid
Produkt-Name |
N-p-Toluenesulfonylimino-3,3'-dipropionic acid |
Englischer Name |
N-p-Toluenesulfonylimino-3,3'-dipropionic acid; N-p-Toluenesulphonylimino-3,3-dipropionic acid; 3,3'-{[(4-methylphenyl)sulfonyl]imino}dipropanoic acid (non-preferred name); N-(2,4-dimethylphenyl)-2-morpholin-4-yl-2-thioxoacetamide |
Molekulare Formel |
C14H18N2O2S |
Molecular Weight |
278.3699 |
InChI |
InChI=1/C14H18N2O2S/c1-10-3-4-12(11(2)9-10)15-13(17)14(19)16-5-7-18-8-6-16/h3-4,9H,5-8H2,1-2H3,(H,15,17) |
CAS Registry Number |
5446-58-2 |
EINECS |
226-660-1 |
Molecular Structure |
|
Dichte |
1.258g/cm3 |
Schmelzpunkt |
170-173℃ |
Brechungsindex |
1.632 |
Gefahrensymbole |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|