ChemNet > CAS > 5447-99-4 3-Nitro-2-pentanol
5447-99-4 3-Nitro-2-pentanol
| Produkt-Name |
3-Nitro-2-pentanol |
| Englischer Name |
3-Nitro-2-pentanol; 3-Nitro-2-pentanol,mixture of (?-threo and (?-erythro; 3-nitropentan-2-ol; (2R,3S)-3-nitropentan-2-ol; (2R,3R)-3-nitropentan-2-ol; (2S,3S)-3-nitropentan-2-ol; (2S,3R)-3-nitropentan-2-ol |
| Molekulare Formel |
C5H11NO3 |
| Molecular Weight |
133.1457 |
| InChI |
InChI=1/C5H11NO3/c1-3-5(4(2)7)6(8)9/h4-5,7H,3H2,1-2H3/t4-,5+/m0/s1 |
| CAS Registry Number |
5447-99-4 |
| EINECS |
226-669-0 |
| Molecular Structure |
|
| Dichte |
1.09g/cm3 |
| Siedepunkt |
215.8°C at 760 mmHg |
| Brechungsindex |
1.447 |
| Flammpunkt |
90.6°C |
| Dampfdruck |
0.0314mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
