ChemNet > CAS > 5467-72-1 4-Bromophenacylamine hydrochloride
5467-72-1 4-Bromophenacylamine hydrochloride
| Produkt-Name |
4-Bromophenacylamine hydrochloride |
| Englischer Name |
4-Bromophenacylamine hydrochloride; 2-Amino-4'-Bromoacetophenone Hydrochloride; 2-Amino-4'-bromoacetophenone HCl |
| Molekulare Formel |
C8H8BrNO |
| Molecular Weight |
214.0592 |
| InChI |
InChI=1/C8H8BrNO/c9-7-3-1-6(2-4-7)8(11)5-10/h1-4H,5,10H2 |
| CAS Registry Number |
5467-72-1 |
| EINECS |
226-778-3 |
| Molecular Structure |
|
| Dichte |
1.52g/cm3 |
| Schmelzpunkt |
265℃ |
| Siedepunkt |
322.8°C at 760 mmHg |
| Brechungsindex |
1.589 |
| Flammpunkt |
149°C |
| Dampfdruck |
0.000272mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
