ChemNet > CAS > 553-86-6 2-Coumaranone
553-86-6 2-Coumaranone
| Produkt-Name |
2-Coumaranone |
| Englischer Name |
2-Coumaranone; 3H-Benzofuran-2-one; 2,3-Dihydrobenzofuran-2-one; 2,3-Dihydrobenzo[b]furan-2-one; Benzofuran-2(3H)-one; 2(3H)-Benzofuranone; Benzo-furanone; 1-benzofuran-2(3H)-one; Coumarone-2(3H)-ketone |
| Molekulare Formel |
C8H6O2 |
| Molecular Weight |
134.132 |
| InChI |
InChI=1/C8H6O2/c9-8-5-6-3-1-2-4-7(6)10-8/h1-4H,5H2 |
| CAS Registry Number |
553-86-6 |
| EINECS |
209-052-0 |
| Molecular Structure |
|
| Dichte |
1.264g/cm3 |
| Schmelzpunkt |
47-52℃ |
| Siedepunkt |
249°C at 760 mmHg |
| Brechungsindex |
1.585 |
| Flammpunkt |
96.9°C |
| Dampfdruck |
0.0235mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
