ChemNet > CAS > 55406-13-8 3-Methylthiophene-2-carbonitrile
55406-13-8 3-Methylthiophene-2-carbonitrile
| Produkt-Name |
3-Methylthiophene-2-carbonitrile |
| Englischer Name |
3-Methylthiophene-2-carbonitrile; 2-Cyano-3-methylthiophene |
| Molekulare Formel |
C6H5NS |
| Molecular Weight |
123.1756 |
| InChI |
InChI=1/C6H5NS/c1-5-2-3-8-6(5)4-7/h2-3H,1H3 |
| CAS Registry Number |
55406-13-8 |
| Molecular Structure |
|
| Dichte |
1.16g/cm3 |
| Siedepunkt |
212.7°C at 760 mmHg |
| Brechungsindex |
1.556 |
| Flammpunkt |
82.4°C |
| Dampfdruck |
0.171mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
