557-35-7 2-Bromooctane
Produkt-Name |
2-Bromooctane |
Englischer Name |
2-Bromooctane;sec-Octyl bromide; 1-Methylheptyl bromide; 2-Bromoooctane; 2-Octyl bromide; NSC 8060; sec-Octyl bromide (VAN); Octane, 2-bromo- |
Molekulare Formel |
C8H17Br |
Molecular Weight |
193.1246 |
InChI |
InChI=1/C8H17Br/c1-3-4-5-6-7-8(2)9/h8H,3-7H2,1-2H3 |
CAS Registry Number |
557-35-7 |
EINECS |
209-171-8 |
Molecular Structure |
|
Dichte |
1.108g/cm3 |
Siedepunkt |
190.8°C at 760 mmHg |
Brechungsindex |
1.45 |
Flammpunkt |
56.1°C |
Dampfdruck |
0.739mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|