ChemNet > CAS > 55776-17-5 2,6-Dimethoxy-3-nitrobenzoic acid
55776-17-5 2,6-Dimethoxy-3-nitrobenzoic acid
| Produkt-Name |
2,6-Dimethoxy-3-nitrobenzoic acid |
| Englischer Name |
2,6-Dimethoxy-3-nitrobenzoic acid; |
| Molekulare Formel |
C9H9NO6 |
| Molecular Weight |
227.1709 |
| InChI |
InChI=1/C9H9NO6/c1-15-6-4-3-5(10(13)14)8(16-2)7(6)9(11)12/h3-4H,1-2H3,(H,11,12) |
| CAS Registry Number |
55776-17-5 |
| EINECS |
259-814-1 |
| Molecular Structure |
|
| Dichte |
1.403g/cm3 |
| Siedepunkt |
420.7°C at 760 mmHg |
| Brechungsindex |
1.569 |
| Flammpunkt |
208.2°C |
| Dampfdruck |
7.92E-08mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
