55836-71-0 4-ethoxybenzamide
Produkt-Name |
4-ethoxybenzamide |
Englischer Name |
4-ethoxybenzamide; p-Ethoxybenzamide; 4-ethoxy benzamide |
Molekulare Formel |
C9H11NO2 |
Molecular Weight |
165.1891 |
InChI |
InChI=1/C9H11NO2/c1-2-12-8-5-3-7(4-6-8)9(10)11/h3-6H,2H2,1H3,(H2,10,11) |
CAS Registry Number |
55836-71-0 |
EINECS |
259-847-1 |
Molecular Structure |
|
Dichte |
1.111g/cm3 |
Schmelzpunkt |
208-210℃ |
Siedepunkt |
307.7°C at 760 mmHg |
Brechungsindex |
1.538 |
Flammpunkt |
159°C |
Dampfdruck |
0.000714mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|