5585-33-1 2-(4-Morpholino)aniline
Produkt-Name |
2-(4-Morpholino)aniline |
Englischer Name |
2-(4-Morpholino)aniline; 4-(2-Aminophenyl)morpholine; 2-(morpholin-4-yl)aniline; 2-morpholinoaniline |
Molekulare Formel |
C10H14N2O |
Molecular Weight |
178.231 |
InChI |
InChI=1/C10H14N2O/c11-9-3-1-2-4-10(9)12-5-7-13-8-6-12/h1-4H,5-8,11H2 |
CAS Registry Number |
5585-33-1 |
Molecular Structure |
|
Dichte |
1.149g/cm3 |
Schmelzpunkt |
93℃ |
Siedepunkt |
332.5°C at 760 mmHg |
Brechungsindex |
1.589 |
Flammpunkt |
154.9°C |
Dampfdruck |
0.000146mmHg at 25°C |
Gefahrensymbole |
Xn:Harmful;
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Beschreibung |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|