ChemNet > CAS > 5619-07-8 DL-Phenylalanine methyl ester hydrochloride
5619-07-8 DL-Phenylalanine methyl ester hydrochloride
| Produkt-Name |
DL-Phenylalanine methyl ester hydrochloride |
| Englischer Name |
DL-Phenylalanine methyl ester hydrochloride; H-DL-Phe-OMe.HCl; methyl L-phenylalaninate hydrochloride (1:1); methyl phenylalaninate hydrochloride; H-DL-Phe-OMe・HCl |
| Molekulare Formel |
C10H14ClNO2 |
| Molecular Weight |
215.6767 |
| InChI |
InChI=1/C10H13NO2.ClH/c1-13-10(12)9(11)7-8-5-3-2-4-6-8;/h2-6,9H,7,11H2,1H3;1H |
| CAS Registry Number |
5619-07-8 |
| EINECS |
227-049-2 |
| Molecular Structure |
|
| Siedepunkt |
264.2°C at 760 mmHg |
| Flammpunkt |
126°C |
| Dampfdruck |
0.00986mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
