564-94-3 (-)-Myrtenal
Produkt-Name |
(-)-Myrtenal |
Synonyme |
;(1R)-()-Myrtenal; Pin-2-en-1-carbaldehyd; 6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-carbaldehyd; (1R,5S)-6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-carbaldehyd |
Englischer Name |
(-)-Myrtenal; (1R)-()-Myrtenal; pin-2-ene-1-carbaldehyde; 6,6-dimethylbicyclo[3.1.1]hept-2-ene-2-carbaldehyde; (1R,5S)-6,6-dimethylbicyclo[3.1.1]hept-2-ene-2-carbaldehyde |
Molekulare Formel |
C10H14O |
Molecular Weight |
150.2176 |
InChI |
InChI=1/C10H14O/c1-10(2)8-4-3-7(6-11)9(10)5-8/h3,6,8-9H,4-5H2,1-2H3/t8-,9-/m0/s1 |
CAS Registry Number |
564-94-3 |
EINECS |
209-274-8 |
Molecular Structure |
|
Dichte |
1.061g/cm3 |
Siedepunkt |
215.7°C at 760 mmHg |
Brechungsindex |
1.561 |
Flammpunkt |
78.9°C |
Dampfdruck |
0.145mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|