ChemNet > CAS > 570-02-5 2,4,6-Trimethoxybenzoic acid
570-02-5 2,4,6-Trimethoxybenzoic acid
Produkt-Name |
2,4,6-Trimethoxybenzoic acid |
Englischer Name |
2,4,6-Trimethoxybenzoic acid;Benzoic acid, 2,4,6-trimethoxy- |
Molekulare Formel |
C10H12O5 |
Molecular Weight |
212.1993 |
InChI |
InChI=1/C10H12O5/c1-13-6-4-7(14-2)9(10(11)12)8(5-6)15-3/h4-5H,1-3H3,(H,11,12) |
CAS Registry Number |
570-02-5 |
EINECS |
209-325-4 |
Molecular Structure |
|
Dichte |
1.219g/cm3 |
Siedepunkt |
350.6°C at 760 mmHg |
Brechungsindex |
1.523 |
Flammpunkt |
137.4°C |
Dampfdruck |
1.62E-05mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|