ChemNet > CAS > 571-61-9 1,5-Dimethylnaphthalene
571-61-9 1,5-Dimethylnaphthalene
| Produkt-Name |
1,5-Dimethylnaphthalene |
| Englischer Name |
1,5-Dimethylnaphthalene;NSC 59388; Naphthalene, 1,5-dimethyl-; Naphthalene, 1,5-dimethyl- (8CI)(9CI); N-methyl-N-nitrosomethanamine |
| Molekulare Formel |
C12H12 |
| Molecular Weight |
156.2237 |
| InChI |
InChI=1/C12H12/c1-9-5-3-8-12-10(2)6-4-7-11(9)12/h3-8H,1-2H3 |
| CAS Registry Number |
571-61-9 |
| EINECS |
209-338-5 |
| Molecular Structure |
|
| Dichte |
1g/cm3 |
| Schmelzpunkt |
78-266℃ |
| Siedepunkt |
265.6°C at 760 mmHg |
| Brechungsindex |
1.604 |
| Flammpunkt |
111.4°C |
| Dampfdruck |
0.0149mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
