ChemNet > CAS > 57264-46-7 2-Chloro-6-methylbenzylamine
57264-46-7 2-Chloro-6-methylbenzylamine
| Produkt-Name |
2-Chloro-6-methylbenzylamine |
| Englischer Name |
2-Chloro-6-methylbenzylamine;1-(2-chloro-6-methylphenyl)methanamine |
| Molekulare Formel |
C8H10ClN |
| Molecular Weight |
155.6247 |
| InChI |
InChI=1/C8H10ClN/c1-6-3-2-4-8(9)7(6)5-10/h2-4H,5,10H2,1H3 |
| CAS Registry Number |
57264-46-7 |
| Molecular Structure |
|
| Dichte |
1.13g/cm3 |
| Siedepunkt |
242.8°C at 760 mmHg |
| Brechungsindex |
1.558 |
| Flammpunkt |
115.9°C |
| Dampfdruck |
0.0332mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
