ChemNet > CAS > 57319-65-0 6-amino-1,3-dihydroisobenzofuran-1-one
57319-65-0 6-amino-1,3-dihydroisobenzofuran-1-one
| Produkt-Name |
6-amino-1,3-dihydroisobenzofuran-1-one |
| Englischer Name |
6-amino-1,3-dihydroisobenzofuran-1-one; 6-Aminophtalide; 6-amino-2-benzofuran-1(3H)-one |
| Molekulare Formel |
C8H7NO2 |
| Molecular Weight |
149.1467 |
| InChI |
InChI=1/C8H7NO2/c9-6-2-1-5-4-11-8(10)7(5)3-6/h1-3H,4,9H2 |
| CAS Registry Number |
57319-65-0 |
| EINECS |
260-675-4 |
| Molecular Structure |
|
| Dichte |
1.376g/cm3 |
| Schmelzpunkt |
182℃ |
| Siedepunkt |
420.2°C at 760 mmHg |
| Brechungsindex |
1.655 |
| Flammpunkt |
248.3°C |
| Dampfdruck |
2.87E-07mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
