57455-06-8 3-Iodobenzyl alcohol
Produkt-Name |
3-Iodobenzyl alcohol |
Englischer Name |
3-Iodobenzyl alcohol; Benzyl alcohol, m-iodo-; BRN 3234821; Benzenemethanol, 3-iodo-; m-Iodobenzyl alcohol; (3-iodophenyl)methanol |
Molekulare Formel |
C7H7IO |
Molecular Weight |
234.0343 |
InChI |
InChI=1/C7H7IO/c8-7-3-1-2-6(4-7)5-9/h1-4,9H,5H2 |
CAS Registry Number |
57455-06-8 |
EINECS |
260-744-9 |
Molecular Structure |
|
Dichte |
1.867g/cm3 |
Siedepunkt |
254.7°C at 760 mmHg |
Brechungsindex |
1.648 |
Flammpunkt |
129.8°C |
Dampfdruck |
0.00881mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|