575-43-9 1,6-Dimethylnaphthalene
Produkt-Name |
1,6-Dimethylnaphthalene |
Englischer Name |
1,6-Dimethylnaphthalene;AI3-17608; HSDB 6024; NSC 52966; Naphthalene, 1,6-dimethyl-; Naphthalene, 1,6-dimethyl- (8CI)(9CI) |
Molekulare Formel |
C12H12 |
Molecular Weight |
156.2237 |
InChI |
InChI=1/C12H12/c1-9-6-7-12-10(2)4-3-5-11(12)8-9/h3-8H,1-2H3 |
CAS Registry Number |
575-43-9 |
EINECS |
209-385-1 |
Molecular Structure |
|
Dichte |
1g/cm3 |
Siedepunkt |
264.4°C at 760 mmHg |
Brechungsindex |
1.604 |
Flammpunkt |
110.5°C |
Dampfdruck |
0.0159mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|