589-82-2 3-Heptanol
Produkt-Name |
3-Heptanol |
Englischer Name |
3-Heptanol; heptan-3-ol; (3R)-heptan-3-ol; (3S)-heptan-3-ol |
Molekulare Formel |
C7H16O |
Molecular Weight |
116.2013 |
InChI |
InChI=1/C7H16O/c1-3-5-6-7(8)4-2/h7-8H,3-6H2,1-2H3/t7-/m0/s1 |
CAS Registry Number |
589-82-2 |
EINECS |
209-661-1 |
Molecular Structure |
|
Dichte |
0.818g/cm3 |
Schmelzpunkt |
-70℃ |
Siedepunkt |
156.7°C at 760 mmHg |
Brechungsindex |
1.42 |
Flammpunkt |
54.4°C |
Dampfdruck |
1.03mmHg at 25°C |
Gefahrensymbole |
Xn:Harmful;
|
Risk Codes |
R22:Harmful if swallowed.;
R36:Irritating to eyes.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|