ChemNet > CAS > 589-98-0;20296-29-1 3-Octanol
589-98-0;20296-29-1 3-Octanol
| Produkt-Name |
3-Octanol |
| Englischer Name |
3-Octanol; DL-3-Octanol; ethylpentylcarbinol; n-Amyl ethyl carbinol; Ethyl n-pentyl carbinol; (3S)-octan-3-ol; (±)-octan-3-ol; (3R)-octan-3-ol |
| Molekulare Formel |
C8H18O |
| Molecular Weight |
130.2279 |
| InChI |
InChI=1/C8H18O/c1-3-5-6-7-8(9)4-2/h8-9H,3-7H2,1-2H3/t8-/m0/s1 |
| CAS Registry Number |
589-98-0;20296-29-1 |
| EINECS |
209-667-4 |
| Molecular Structure |
|
| Dichte |
0.821g/cm3 |
| Schmelzpunkt |
-45℃ |
| Siedepunkt |
169°C at 760 mmHg |
| Brechungsindex |
1.426 |
| Flammpunkt |
65.6°C |
| Dampfdruck |
0.512mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
