5933-32-4 4-Bromobenzhydrazide
Produkt-Name |
4-Bromobenzhydrazide |
Englischer Name |
4-Bromobenzhydrazide; 4-Bromobenzoic hydrazide; 4-bromobenzohydrazide |
Molekulare Formel |
C7H7BrN2O |
Molecular Weight |
215.0473 |
InChI |
InChI=1/C7H7BrN2O/c8-6-3-1-5(2-4-6)7(11)10-9/h1-4H,9H2,(H,10,11) |
CAS Registry Number |
5933-32-4 |
EINECS |
227-681-9 |
Molecular Structure |
|
Dichte |
1.615g/cm3 |
Schmelzpunkt |
165-167℃ |
Siedepunkt |
353.2°C at 760 mmHg |
Brechungsindex |
1.615 |
Flammpunkt |
167.4°C |
Dampfdruck |
1.34E-05mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|