596-09-8 Fluorescein diacetate
Produkt-Name |
Fluorescein diacetate |
Englischer Name |
Fluorescein diacetate; Diacetylfluorescein; Fluorescein Diacetat; 3-oxo-3H-spiro[2-benzofuran-1,9'-xanthene]-3',6'-diyl diacetate |
Molekulare Formel |
C24H16O7 |
Molecular Weight |
416.3796 |
InChI |
InChI=1/C24H16O7/c1-13(25)28-15-7-9-19-21(11-15)30-22-12-16(29-14(2)26)8-10-20(22)24(19)18-6-4-3-5-17(18)23(27)31-24/h3-12H,1-2H3 |
CAS Registry Number |
596-09-8 |
EINECS |
209-877-6 |
Molecular Structure |
|
Dichte |
1.47g/cm3 |
Schmelzpunkt |
206-208℃ |
Siedepunkt |
604.7°C at 760 mmHg |
Brechungsindex |
1.681 |
Flammpunkt |
264°C |
Dampfdruck |
1.42E-14mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|