596-38-3 9-Phenylxanthen-9-ol
Produkt-Name |
9-Phenylxanthen-9-ol |
Synonyme |
;P Henylxanthenol; 9-Phenyl-9H-xanthen-9-ol |
Englischer Name |
9-Phenylxanthen-9-ol; Phenylxanthenol; 9-phenyl-9H-xanthen-9-ol |
Molekulare Formel |
C19H14O2 |
Molecular Weight |
274.3133 |
InChI |
InChI=1/C19H14O2/c20-19(14-8-2-1-3-9-14)15-10-4-6-12-17(15)21-18-13-7-5-11-16(18)19/h1-13,20H |
CAS Registry Number |
596-38-3 |
EINECS |
209-882-3 |
Molecular Structure |
|
Dichte |
1.265g/cm3 |
Schmelzpunkt |
158-162℃ |
Siedepunkt |
432.6°C at 760 mmHg |
Brechungsindex |
1.674 |
Flammpunkt |
199.7°C |
Dampfdruck |
2.98E-08mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|