ChemNet > CAS > 601-79-6 Isopropylmalonic acid
601-79-6 Isopropylmalonic acid
| Produkt-Name |
Isopropylmalonic acid |
| Englischer Name |
Isopropylmalonic acid; isopropyl malonic acid; propan-2-ylpropanedioic acid; (1-methylethyl)propanedioate |
| Molekulare Formel |
C6H8O4 |
| Molecular Weight |
144.1264 |
| InChI |
InChI=1/C6H10O4/c1-3(2)4(5(7)8)6(9)10/h3-4H,1-2H3,(H,7,8)(H,9,10)/p-2 |
| CAS Registry Number |
601-79-6 |
| EINECS |
210-008-8 |
| Molecular Structure |
|
| Siedepunkt |
315.4°C at 760 mmHg |
| Flammpunkt |
158.7°C |
| Dampfdruck |
9.44E-05mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
