602-55-1 9-Phenylanthracene
Produkt-Name |
9-Phenylanthracene |
Englischer Name |
9-Phenylanthracene; Phenylanthracene; anthracene,9-phenyl-; 9-phenylantracene |
Molekulare Formel |
C20H14 |
Molecular Weight |
254.3252 |
InChI |
InChI=1/C20H14/c1-2-8-15(9-3-1)20-18-12-6-4-10-16(18)14-17-11-5-7-13-19(17)20/h1-14H |
CAS Registry Number |
602-55-1 |
EINECS |
210-019-8 |
Molecular Structure |
|
Dichte |
1.14g/cm3 |
Schmelzpunkt |
149-153℃ |
Siedepunkt |
417°C at 760 mmHg |
Brechungsindex |
1.703 |
Flammpunkt |
192.1°C |
Dampfdruck |
8.86E-07mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|