602-60-8 9-nitroanthracene
Produkt-Name |
9-nitroanthracene |
Englischer Name |
9-nitroanthracene; 9-Nitroanthracene (purity); 1-nitroanthracene |
Molekulare Formel |
C14H9NO2 |
Molecular Weight |
223.2268 |
InChI |
InChI=1/C14H9NO2/c16-15(17)14-7-3-6-12-8-10-4-1-2-5-11(10)9-13(12)14/h1-9H |
CAS Registry Number |
602-60-8 |
EINECS |
210-021-9 |
Molecular Structure |
|
Dichte |
1.316g/cm3 |
Schmelzpunkt |
144-144℃ |
Siedepunkt |
413.3°C at 760 mmHg |
Brechungsindex |
1.741 |
Flammpunkt |
207.5°C |
Dampfdruck |
1.16E-06mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|