605-02-7 1-Phenylnaphthalene
Produkt-Name |
1-Phenylnaphthalene |
Englischer Name |
1-Phenylnaphthalene;NSC 5257; Naphthalene, 1-phenyl-; Naphthalene, 1-phenyl- (8CI)(9CI) |
Molekulare Formel |
C16H12 |
Molecular Weight |
204.2665 |
InChI |
InChI=1/C16H12/c1-2-7-13(8-3-1)16-12-6-10-14-9-4-5-11-15(14)16/h1-12H |
CAS Registry Number |
605-02-7 |
EINECS |
210-081-6 |
Molecular Structure |
|
Dichte |
1.081g/cm3 |
Siedepunkt |
336.4°C at 760 mmHg |
Brechungsindex |
1.647 |
Flammpunkt |
148.2°C |
Dampfdruck |
0.000219mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|