605-62-9 4-Nitro-1-Naphthol
Produkt-Name |
4-Nitro-1-Naphthol |
Englischer Name |
4-Nitro-1-Naphthol; 4-nitronaphthalen-1-ol |
Molekulare Formel |
C10H7NO3 |
Molecular Weight |
189.1675 |
InChI |
InChI=1/C10H7NO3/c12-10-6-5-9(11(13)14)7-3-1-2-4-8(7)10/h1-6,12H |
CAS Registry Number |
605-62-9 |
Molecular Structure |
|
Dichte |
1.413g/cm3 |
Siedepunkt |
398.8°C at 760 mmHg |
Brechungsindex |
1.714 |
Flammpunkt |
179.8°C |
Dampfdruck |
6.25E-07mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Beschreibung |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|