608-08-2 Indoxyl acetate
Produkt-Name |
Indoxyl acetate |
Englischer Name |
Indoxyl acetate; 3-Acetoxyindole~Indolyl acetate~Y-acetate; Indoxyl acetate 3-Indoxyl acetate; 3-Indolyl acetate; 3-Acetoxyindole; 1H-indol-3-yl acetate |
Molekulare Formel |
C10H9NO2 |
Molecular Weight |
175.184 |
InChI |
InChI=1/C10H9NO2/c1-7(12)13-10-6-11-9-5-3-2-4-8(9)10/h2-6,11H,1H3 |
CAS Registry Number |
608-08-2 |
EINECS |
210-154-2 |
Molecular Structure |
|
Dichte |
1.255g/cm3 |
Schmelzpunkt |
128-131℃ |
Siedepunkt |
339.1°C at 760 mmHg |
Brechungsindex |
1.633 |
Flammpunkt |
158.9°C |
Dampfdruck |
9.41E-05mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|