ChemNet > CAS > 613-54-7 alpha-Bromo-2'-acetonaphthone
613-54-7 alpha-Bromo-2'-acetonaphthone
| Produkt-Name |
alpha-Bromo-2'-acetonaphthone |
| Englischer Name |
alpha-Bromo-2'-acetonaphthone; Bromomethyl 2-naphthyl ketone; alpha-Bromo-2-acetonaphthone; 2-(Bromoacetyl)naphthalene; 2-(Bromoacetyl)naphthalene; 2-bromo-1-(naphthalen-2-yl)ethanone; α-Bromo-2-acetonaphthone; 2-Bromo-2'-acetonaphthone; 2-Bromo-1-(2-naphthyl)-1-ethanone |
| Molekulare Formel |
C12H9BrO |
| Molecular Weight |
249.1033 |
| InChI |
InChI=1/C12H9BrO/c13-8-12(14)11-6-5-9-3-1-2-4-10(9)7-11/h1-7H,8H2 |
| CAS Registry Number |
613-54-7 |
| EINECS |
210-348-7 |
| Molecular Structure |
|
| Dichte |
1.48g/cm3 |
| Schmelzpunkt |
82-85℃ |
| Siedepunkt |
349.8°C at 760 mmHg |
| Brechungsindex |
1.656 |
| Flammpunkt |
99.1°C |
| Dampfdruck |
4.59E-05mmHg at 25°C |
| Gefahrensymbole |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
