ChemNet > CAS > 61341-26-2 3-Methylthiophene-2-carbonyl chloride
61341-26-2 3-Methylthiophene-2-carbonyl chloride
| Produkt-Name |
3-Methylthiophene-2-carbonyl chloride |
| Englischer Name |
3-Methylthiophene-2-carbonyl chloride; 2-thiophenecarbonyl chloride, 3-methyl-; 3-METHYLTHIOPHENE-2-CARBONYL CHLORIDE |
| Molekulare Formel |
C6H5ClOS |
| Molecular Weight |
160.6213 |
| InChI |
InChI=1/C6H5ClOS/c1-4-2-3-9-5(4)6(7)8/h2-3H,1H3 |
| CAS Registry Number |
61341-26-2 |
| Molecular Structure |
|
| Dichte |
1.32g/cm3 |
| Siedepunkt |
219.9°C at 760 mmHg |
| Brechungsindex |
1.566 |
| Flammpunkt |
86.8°C |
| Dampfdruck |
0.116mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
