ChemNet > CAS > 61439-59-6 2-(4-Benzyloxyphenyl)ethanol
61439-59-6 2-(4-Benzyloxyphenyl)ethanol
| Produkt-Name |
2-(4-Benzyloxyphenyl)ethanol |
| Englischer Name |
2-(4-Benzyloxyphenyl)ethanol; p-Benzyloxyphenethyl alcohol |
| Molekulare Formel |
C15H16O2 |
| Molecular Weight |
228.2863 |
| InChI |
InChI=1/C15H16O2/c16-11-10-13-6-8-15(9-7-13)17-12-14-4-2-1-3-5-14/h1-9,16H,10-12H2 |
| CAS Registry Number |
61439-59-6 |
| EINECS |
262-795-2 |
| Molecular Structure |
|
| Dichte |
1.116g/cm3 |
| Siedepunkt |
379.1°C at 760 mmHg |
| Brechungsindex |
1.584 |
| Flammpunkt |
170.1°C |
| Dampfdruck |
2.02E-06mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
