ChemNet > CAS > 622-52-6 P-Tolylthiourea
622-52-6 P-Tolylthiourea
| Produkt-Name |
P-Tolylthiourea |
| Englischer Name |
P-Tolylthiourea; 4-Methylphenylthiourea; para-Tolylthiourea;
; 1-(4-methylphenyl)thiourea |
| Molekulare Formel |
C8H10N2S |
| Molecular Weight |
166.2434 |
| InChI |
InChI=1/C8H10N2S/c1-6-2-4-7(5-3-6)10-8(9)11/h2-5H,1H3,(H3,9,10,11) |
| CAS Registry Number |
622-52-6 |
| EINECS |
210-740-8 |
| Molecular Structure |
|
| Dichte |
1.242g/cm3 |
| Siedepunkt |
282.5°C at 760 mmHg |
| Brechungsindex |
1.696 |
| Flammpunkt |
124.6°C |
| Dampfdruck |
0.00335mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R25:Toxic if swallowed.;
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
