ChemNet > CAS > 6223-83-2 9-fluorenone-4-carboxylic acid
6223-83-2 9-fluorenone-4-carboxylic acid
Produkt-Name |
9-fluorenone-4-carboxylic acid |
Englischer Name |
9-fluorenone-4-carboxylic acid; 9-Oxofluorene-4-carboxylic acid; 9-oxo-9H-fluorene-4-carboxylic acid; 9-oxo-9H-fluorene-4-carboxylate |
Molekulare Formel |
C14H7O3 |
Molecular Weight |
223.2041 |
InChI |
InChI=1/C14H8O3/c15-13-9-5-2-1-4-8(9)12-10(13)6-3-7-11(12)14(16)17/h1-7H,(H,16,17)/p-1 |
CAS Registry Number |
6223-83-2 |
EINECS |
228-311-9 |
Molecular Structure |
|
Schmelzpunkt |
225-227℃ |
Siedepunkt |
476.5°C at 760 mmHg |
Flammpunkt |
256.1°C |
Dampfdruck |
6.9E-10mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S22:;
S24/25:;
|
|