ChemNet > CAS > 623-82-5 (+)-3-Methyladipic acid
623-82-5 (+)-3-Methyladipic acid
| Produkt-Name |
(+)-3-Methyladipic acid |
| Englischer Name |
(+)-3-Methyladipic acid; Methylhexanedioic acid; (3R)-3-methylhexanedioic acid; (3R)-3-methylhexanedioate |
| Molekulare Formel |
C7H10O4 |
| Molecular Weight |
158.153 |
| InChI |
InChI=1/C7H12O4/c1-5(4-7(10)11)2-3-6(8)9/h5H,2-4H2,1H3,(H,8,9)(H,10,11)/p-2/t5-/m1/s1 |
| CAS Registry Number |
623-82-5 |
| EINECS |
210-816-0 |
| Molecular Structure |
|
| Schmelzpunkt |
81-84℃ |
| Siedepunkt |
341.4°C at 760 mmHg |
| Flammpunkt |
170.6°C |
| Dampfdruck |
1.47E-05mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
