ChemNet > CAS > 62484-76-8 5,7-Dimethylchromon-3-carboxaldehyd
62484-76-8 5,7-Dimethylchromon-3-carboxaldehyd
| Produkt-Name |
5,7-Dimethylchromon-3-carboxaldehyd |
| Synonyme |
5,7-Dimethyl-4-oxo-4H-chromen-3-carbaldehyd |
| Englischer Name |
5,7-Dimethylchromone-3-carboxaldehyde;5,7-dimethyl-4-oxo-4H-chromene-3-carbaldehyde |
| Molekulare Formel |
C12H10O3 |
| Molecular Weight |
202.206 |
| InChI |
InChI=1/C12H10O3/c1-7-3-8(2)11-10(4-7)15-6-9(5-13)12(11)14/h3-6H,1-2H3 |
| CAS Registry Number |
62484-76-8 |
| Molecular Structure |
|
| Dichte |
1.311g/cm3 |
| Siedepunkt |
362.7°C at 760 mmHg |
| Brechungsindex |
1.646 |
| Flammpunkt |
163.2°C |
| Dampfdruck |
1.9E-05mmHg at 25°C |
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|