625-38-7 Vinylacetic acid
Produkt-Name |
Vinylacetic acid |
Englischer Name |
Vinylacetic acid; 3-Butenoic acid; Vinylacetic acid, (3-Butenoic acid); but-3-enoic acid; but-3-enoate |
Molekulare Formel |
C4H5O2 |
Molecular Weight |
85.0818 |
InChI |
InChI=1/C4H6O2/c1-2-3-4(5)6/h2H,1,3H2,(H,5,6)/p-1 |
CAS Registry Number |
625-38-7 |
EINECS |
210-892-5 |
Molecular Structure |
|
Schmelzpunkt |
-39℃ |
Siedepunkt |
170.6°C at 760 mmHg |
Flammpunkt |
68.2°C |
Dampfdruck |
0.714mmHg at 25°C |
Gefahrensymbole |
C:Corrosive;
|
Risk Codes |
R34:Causes burns.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28A:After contact with skin, wash immediately with plenty of water.;
|
|