ChemNet > CAS > 626-95-9 1,4-Pentanediol
626-95-9 1,4-Pentanediol
| Produkt-Name |
1,4-Pentanediol |
| Englischer Name |
1,4-Pentanediol; Pentane-1,4-diol; AI3-08028 |
| Molekulare Formel |
C5H12O2 |
| Molecular Weight |
104.1476 |
| InChI |
InChI=1/C5H12O2/c1-5(7)3-2-4-6/h5-7H,2-4H2,1H3 |
| CAS Registry Number |
626-95-9 |
| EINECS |
210-973-5 |
| Molecular Structure |
|
| Dichte |
0.978g/cm3 |
| Siedepunkt |
286.8°C at 760 mmHg |
| Brechungsindex |
1.443 |
| Flammpunkt |
99.1°C |
| Dampfdruck |
0.00029mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
