6267-24-9 Tris(ethylthio)methane
Produkt-Name |
Tris(ethylthio)methane |
Englischer Name |
Tris(ethylthio)methane; Ethyl orthothioformate~Triethyl trithioorthoformate; {[bis(ethylsulfanyl)methyl]sulfanyl}ethane |
Molekulare Formel |
C7H16S3 |
Molecular Weight |
196.3969 |
InChI |
InChI=1/C7H16S3/c1-4-8-7(9-5-2)10-6-3/h7H,4-6H2,1-3H3 |
CAS Registry Number |
6267-24-9 |
EINECS |
228-439-5 |
Molecular Structure |
|
Dichte |
1.053g/cm3 |
Siedepunkt |
269.2°C at 760 mmHg |
Brechungsindex |
1.539 |
Flammpunkt |
111.3°C |
Dampfdruck |
0.0122mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|