ChemNet > CAS > 62936-23-6 5-Chlorovanillic acid
62936-23-6 5-Chlorovanillic acid
| Produkt-Name |
5-Chlorovanillic acid |
| Englischer Name |
5-Chlorovanillic acid; 5-Chlorovanilic acid; 5-Chloro-4-hydroxy-3-methoxybenzoic acid; 3-chloro-4-hydroxy-5-methoxybenzoic acid |
| Molekulare Formel |
C8H7ClO4 |
| Molecular Weight |
202.5918 |
| InChI |
InChI=1/C8H7ClO4/c1-13-6-3-4(8(11)12)2-5(9)7(6)10/h2-3,10H,1H3,(H,11,12) |
| CAS Registry Number |
62936-23-6 |
| EINECS |
263-766-7 |
| Molecular Structure |
|
| Dichte |
1.485g/cm3 |
| Schmelzpunkt |
241-243℃ |
| Siedepunkt |
352.3°C at 760 mmHg |
| Brechungsindex |
1.599 |
| Flammpunkt |
166.9°C |
| Dampfdruck |
1.44E-05mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
