ChemNet > CAS > 6336-58-9 3-Dibutylamino-1-propyne
6336-58-9 3-Dibutylamino-1-propyne
| Produkt-Name |
3-Dibutylamino-1-propyne |
| Englischer Name |
3-Dibutylamino-1-propyne;N-butyl-N-(prop-2-yn-1-yl)butan-1-amine |
| Molekulare Formel |
C11H21N |
| Molecular Weight |
167.2911 |
| InChI |
InChI=1/C11H21N/c1-4-7-10-12(9-6-3)11-8-5-2/h3H,4-5,7-11H2,1-2H3 |
| CAS Registry Number |
6336-58-9 |
| Molecular Structure |
|
| Dichte |
0.831g/cm3 |
| Siedepunkt |
224.4°C at 760 mmHg |
| Brechungsindex |
1.454 |
| Flammpunkt |
81.4°C |
| Dampfdruck |
0.0913mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
