ChemNet > CAS > 6345-55-7 5-nitro-1-benzothiophene-2-carboxylic acid
6345-55-7 5-nitro-1-benzothiophene-2-carboxylic acid
| Produkt-Name |
5-nitro-1-benzothiophene-2-carboxylic acid |
| Englischer Name |
5-nitro-1-benzothiophene-2-carboxylic acid;5-nitro-1-benzothiophene-2-carboxylate |
| Molekulare Formel |
C9H4NO4S |
| Molecular Weight |
222.1979 |
| InChI |
InChI=1/C9H5NO4S/c11-9(12)8-4-5-3-6(10(13)14)1-2-7(5)15-8/h1-4H,(H,11,12)/p-1 |
| CAS Registry Number |
6345-55-7 |
| Molecular Structure |
|
| Schmelzpunkt |
238℃ |
| Siedepunkt |
473.6°C at 760 mmHg |
| Flammpunkt |
240.2°C |
| Dampfdruck |
8.93E-10mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
