635-90-5 1-Phenylpyrrole
Produkt-Name |
1-Phenylpyrrole |
Englischer Name |
1-Phenylpyrrole; (1-Pyrrolyl)benzene; 1-phenyl-1H-pyrrole |
Molekulare Formel |
C10H9N |
Molecular Weight |
143.1852 |
InChI |
InChI=1/C10H9N/c1-2-6-10(7-3-1)11-8-4-5-9-11/h1-9H |
CAS Registry Number |
635-90-5 |
EINECS |
211-242-3 |
Molecular Structure |
|
Dichte |
0.97g/cm3 |
Schmelzpunkt |
58-60℃ |
Siedepunkt |
234°C at 760 mmHg |
Brechungsindex |
1.558 |
Flammpunkt |
95.3°C |
Dampfdruck |
0.0827mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|