6359-05-3 Ethyleosin (Kaliumsalz)
Produkt-Name |
Ethyleosin (Kaliumsalz) |
Synonyme |
Eosinalkohol löslich; C.I.45386; Lösungsmittel Rot 45; Ethyl-2-(2,4,5,7-tetrabrom-6-hydroxy-3-oxo-3H-xanthen-9-yl)benzoat |
Englischer Name |
Ethyl Eosin (potassium salt); Eosin alcohol soluble; C.I. 45386; Solvent Red 45; ethyl 2-(2,4,5,7-tetrabromo-6-hydroxy-3-oxo-3H-xanthen-9-yl)benzoate |
Molekulare Formel |
C22H12Br4O5 |
Molecular Weight |
675.9437 |
InChI |
InChI=1/C22H12Br4O5/c1-2-30-22(29)10-6-4-3-5-9(10)15-11-7-13(23)18(27)16(25)20(11)31-21-12(15)8-14(24)19(28)17(21)26/h3-8,27H,2H2,1H3 |
CAS Registry Number |
6359-05-3 |
EINECS |
228-793-0 |
Molecular Structure |
|
Dichte |
2.18g/cm3 |
Siedepunkt |
661.5°C at 760 mmHg |
Brechungsindex |
1.77 |
Flammpunkt |
353.8°C |
Dampfdruck |
4.2E-18mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|