ChemNet > CAS > 63740-97-6 3,4-(Methylenedioxy)butyrophenone
63740-97-6 3,4-(Methylenedioxy)butyrophenone
Produkt-Name |
3,4-(Methylenedioxy)butyrophenone |
Englischer Name |
3,4-(Methylenedioxy)butyrophenone; 1-(1,3-Benzodioxol-5-yl)-1-butanone~5-Butyryl-1,3-benzodioxole; 1-(1,3-benzodioxol-5-yl)butan-1-one |
Molekulare Formel |
C11H12O3 |
Molecular Weight |
192.2112 |
InChI |
InChI=1/C11H12O3/c1-2-3-9(12)8-4-5-10-11(6-8)14-7-13-10/h4-6H,2-3,7H2,1H3 |
CAS Registry Number |
63740-97-6 |
Molecular Structure |
|
Dichte |
1.163g/cm3 |
Siedepunkt |
319.3°C at 760 mmHg |
Brechungsindex |
1.538 |
Flammpunkt |
137.9°C |
Dampfdruck |
0.000342mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|