ChemNet > CAS > 64399-27-5 1-(4-Chlorophenyl)-1-cyclopropanecarbonitrile
64399-27-5 1-(4-Chlorophenyl)-1-cyclopropanecarbonitrile
| Produkt-Name |
1-(4-Chlorophenyl)-1-cyclopropanecarbonitrile |
| Englischer Name |
1-(4-Chlorophenyl)-1-cyclopropanecarbonitrile; 1-(p-Chlorophenyl)cyclopropanecarbonitrile; 1-(4-chlorophenyl)cyclopropanecarbonitrile |
| Molekulare Formel |
C10H8ClN |
| Molecular Weight |
177.6302 |
| InChI |
InChI=1/C10H8ClN/c11-9-3-1-8(2-4-9)10(7-12)5-6-10/h1-4H,5-6H2 |
| CAS Registry Number |
64399-27-5 |
| EINECS |
264-871-0 |
| Molecular Structure |
|
| Dichte |
1.24g/cm3 |
| Schmelzpunkt |
52-56℃ |
| Siedepunkt |
303.1°C at 760 mmHg |
| Brechungsindex |
1.589 |
| Flammpunkt |
133.1°C |
| Dampfdruck |
0.000947mmHg at 25°C |
| Gefahrensymbole |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|