ChemNet > CAS > 64399-28-6 1-(4-Chlorophenyl)-1-cyclohexanecarbonitrile
64399-28-6 1-(4-Chlorophenyl)-1-cyclohexanecarbonitrile
| Produkt-Name |
1-(4-Chlorophenyl)-1-cyclohexanecarbonitrile |
| Englischer Name |
1-(4-Chlorophenyl)-1-cyclohexanecarbonitrile;1-(4-Chlorophenyl)cyclohexanecarbonitrile |
| Molekulare Formel |
C13H14ClN |
| Molecular Weight |
219.71 |
| InChI |
InChI=1/C13H14ClN/c14-12-6-4-11(5-7-12)13(10-15)8-2-1-3-9-13/h4-7H,1-3,8-9H2 |
| CAS Registry Number |
64399-28-6 |
| EINECS |
264-872-6 |
| Molecular Structure |
|
| Dichte |
1.14g/cm3 |
| Schmelzpunkt |
88-92℃ |
| Siedepunkt |
350.5°C at 760 mmHg |
| Brechungsindex |
1.559 |
| Flammpunkt |
143.5°C |
| Dampfdruck |
4.38E-05mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
