ChemNet > CAS > 6484-25-9 4-Chlor-2-phenylchinazolin
6484-25-9 4-Chlor-2-phenylchinazolin
| Produkt-Name |
4-Chlor-2-phenylchinazolin |
| Synonyme |
AM-ex-OL |
| Englischer Name |
4-Chloro-2-phenylquinazoline; AM-ex-OL |
| Molekulare Formel |
C14H9ClN2 |
| Molecular Weight |
240.6877 |
| InChI |
InChI=1/C14H9ClN2/c15-13-11-8-4-5-9-12(11)16-14(17-13)10-6-2-1-3-7-10/h1-9H |
| CAS Registry Number |
6484-25-9 |
| EINECS |
229-346-2 |
| Molecular Structure |
|
| Dichte |
1.285g/cm3 |
| Schmelzpunkt |
123-128℃ |
| Siedepunkt |
301.2°C at 760 mmHg |
| Brechungsindex |
1.667 |
| Flammpunkt |
164.4°C |
| Dampfdruck |
0.00191mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
