65365-28-8 H-D-Pro-OMe . HCl
Produkt-Name |
H-D-Pro-OMe . HCl |
Englischer Name |
H-D-Pro-OMe . HCl; H-D-Pro-OMe.HCl; H-D-Pro-OMe*HCl; D-Proline methyl ester hydrochloride; D-Proline Methyl Ester HCl; methyl (2R)-pyrrolidin-1-ium-2-carboxylate chloride; H-D-Pro-OMe・HCl |
Molekulare Formel |
C6H12ClNO2 |
Molecular Weight |
165.618 |
InChI |
InChI=1/C6H11NO2.ClH/c1-9-6(8)5-3-2-4-7-5;/h5,7H,2-4H2,1H3;1H/t5-;/m1./s1 |
CAS Registry Number |
65365-28-8 |
Molecular Structure |
|
Gefahrensymbole |
|
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|