6548-09-0 5-Bromo-DL-tryptophan
Produkt-Name |
5-Bromo-DL-tryptophan |
Englischer Name |
5-Bromo-DL-tryptophan; 2-Amino-3-(5-bromo-1H-indol-3-yl)propanoic acid; 5-bromotryptophan |
Molekulare Formel |
C11H11BrN2O2 |
Molecular Weight |
283.1212 |
InChI |
InChI=1/C11H11BrN2O2/c12-7-1-2-10-8(4-7)6(5-14-10)3-9(13)11(15)16/h1-2,4-5,9,14H,3,13H2,(H,15,16)/t9-/m1/s1 |
CAS Registry Number |
6548-09-0 |
EINECS |
229-464-4 |
Molecular Structure |
|
Dichte |
1.704g/cm3 |
Schmelzpunkt |
264-267℃ |
Siedepunkt |
495.8°C at 760 mmHg |
Brechungsindex |
1.718 |
Flammpunkt |
253.7°C |
Dampfdruck |
1.19E-10mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|