ChemNet > CAS > 65813-53-8 2-Phenylpropyl isobutyrate
65813-53-8 2-Phenylpropyl isobutyrate
| Produkt-Name |
2-Phenylpropyl isobutyrate |
| Englischer Name |
2-Phenylpropyl isobutyrate; beta-methylphenethyl isobutyrate; 2-phenylpropyl 2-methylpropanoate; (2S)-2-phenylpropyl 2-methylpropanoate; (2R)-2-phenylpropyl 2-methylpropanoate |
| Molekulare Formel |
C13H18O2 |
| Molecular Weight |
206.2808 |
| InChI |
InChI=1/C13H18O2/c1-10(2)13(14)15-9-11(3)12-7-5-4-6-8-12/h4-8,10-11H,9H2,1-3H3/t11-/m0/s1 |
| CAS Registry Number |
65813-53-8 |
| EINECS |
265-931-9 |
| Molecular Structure |
|
| Dichte |
0.985g/cm3 |
| Siedepunkt |
271.3°C at 760 mmHg |
| Brechungsindex |
1.491 |
| Flammpunkt |
100.8°C |
| Dampfdruck |
0.00649mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
